Other Solvents
Filtered Search Results
n-Hexane-d{14}, 99%(Isotopic)
CAS: 21666-38-6 Molecular Formula: C6H14 Molecular Weight (g/mol): 100.26 MDL Number: MFCD00037562 InChI Key: VLKZOEOYAKHREP-ZLKPZJALSA-N Synonym: hexane-d14,tetradecadeuterohexane,n-hexane-d 14,2h14 hexane,2 h?? hexane,hexane-d14, 99 atom % d PubChem CID: 140854 IUPAC Name: 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]
| PubChem CID | 140854 |
|---|---|
| CAS | 21666-38-6 |
| Molecular Weight (g/mol) | 100.26 |
| MDL Number | MFCD00037562 |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| Synonym | hexane-d14,tetradecadeuterohexane,n-hexane-d 14,2h14 hexane,2 h?? hexane,hexane-d14, 99 atom % d |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane |
| InChI Key | VLKZOEOYAKHREP-ZLKPZJALSA-N |
| Molecular Formula | C6H14 |
Trifluoroacetic acid-d, 99.5%(Isotopic)
CAS: 599-00-8 Molecular Formula: C2HF3O2 Molecular Weight (g/mol): 115.029 MDL Number: MFCD00044563 InChI Key: DTQVDTLACAAQTR-DYCDLGHISA-N Synonym: trifluoroacetic acid-d,deuterotrifluoroacetic acid,acetic acid-d, trifluoro,acetic acid-d,2,2,2-trifluoro,acetic acid-d, 2,2,2-trifluoro,trifluoroacetic acid-d tfa-d,trifluoroacetic acid-d, 99.5 atom % d,tfa-d,cf3cood,trifluoroacetic 2h acid PubChem CID: 71502 IUPAC Name: deuterio 2,2,2-trifluoroacetate SMILES: C(=O)(C(F)(F)F)O
| PubChem CID | 71502 |
|---|---|
| CAS | 599-00-8 |
| Molecular Weight (g/mol) | 115.029 |
| MDL Number | MFCD00044563 |
| SMILES | C(=O)(C(F)(F)F)O |
| Synonym | trifluoroacetic acid-d,deuterotrifluoroacetic acid,acetic acid-d, trifluoro,acetic acid-d,2,2,2-trifluoro,acetic acid-d, 2,2,2-trifluoro,trifluoroacetic acid-d tfa-d,trifluoroacetic acid-d, 99.5 atom % d,tfa-d,cf3cood,trifluoroacetic 2h acid |
| IUPAC Name | deuterio 2,2,2-trifluoroacetate |
| InChI Key | DTQVDTLACAAQTR-DYCDLGHISA-N |
| Molecular Formula | C2HF3O2 |
Deuterium chloride, for NMR, 20 wt. % solution in D2O, 100.0 atom % D
CAS: 7698-05-7 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00044642 InChI Key: VEXZGXHMUGYJMC-FTGQXOHASA-N Synonym: deuterium chloride,hydrochloric acid-d,deuterium chloride, 20 wt% in deuterium oxide,chlorohydrogen,hydrochloric acid d,chloro 2h,deuterium chloride, 99 atom % d,deuterium chloride, 1 m in deuterium oxide,deuterium chloride, 0.1 m in deuterium oxide,deuterium chloride, 38 wt% in deuterium oxide PubChem CID: 522634 SMILES: Cl
| PubChem CID | 522634 |
|---|---|
| CAS | 7698-05-7 |
| Molecular Weight (g/mol) | 36.46 |
| MDL Number | MFCD00044642 |
| SMILES | Cl |
| Synonym | deuterium chloride,hydrochloric acid-d,deuterium chloride, 20 wt% in deuterium oxide,chlorohydrogen,hydrochloric acid d,chloro 2h,deuterium chloride, 99 atom % d,deuterium chloride, 1 m in deuterium oxide,deuterium chloride, 0.1 m in deuterium oxide,deuterium chloride, 38 wt% in deuterium oxide |
| InChI Key | VEXZGXHMUGYJMC-FTGQXOHASA-N |
| Molecular Formula | ClH |
Naphthalene, 99+%, scintillation grade
CAS: 91-20-3 Molecular Formula: C10H8 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00001742 InChI Key: UFWIBTONFRDIAS-UHFFFAOYSA-N PubChem CID: 931 ChEBI: CHEBI:16482 IUPAC Name: naphthalene SMILES: C1=CC2=CC=CC=C2C=C1
| PubChem CID | 931 |
|---|---|
| CAS | 91-20-3 |
| Molecular Weight (g/mol) | 128.17 |
| ChEBI | CHEBI:16482 |
| MDL Number | MFCD00001742 |
| SMILES | C1=CC2=CC=CC=C2C=C1 |
| IUPAC Name | naphthalene |
| InChI Key | UFWIBTONFRDIAS-UHFFFAOYSA-N |
| Molecular Formula | C10H8 |
TraceCERT™ Chloroform, 5000 μg/mL, Certified Reference Material, MilliporeSigma™ Supelco™
This certified reference material (CRM) is produced and certified in accordance with ISO/IEC 17025 and ISO 17034. This CRM is traceable to the SI through a primary reference material from a NMI. Certified content incl. uncertainty and expiry date are stated on the enclosed certificate.
Formamide, puriss. p.a., ACS Reagent, ≥99.5% (GC/T), Honeywell Riedel-de Haën™
CAS: 75-12-7 Molecular Formula: CH3NO Molecular Weight (g/mol): 45.04 MDL Number: MFCD00007941 InChI Key: ZHNUHDYFZUAESO-UHFFFAOYSA-N Synonym: methanamide,carbamaldehyde,formimidic acid,formic acid, amide,formamid,methanoic acid, amide,amid kyseliny mravenci,amid kyseliny mravenci czech,formic amide,hsdb 88 PubChem CID: 713 ChEBI: CHEBI:48431 IUPAC Name: formamide SMILES: NC=O
| PubChem CID | 713 |
|---|---|
| CAS | 75-12-7 |
| Molecular Weight (g/mol) | 45.04 |
| ChEBI | CHEBI:48431 |
| MDL Number | MFCD00007941 |
| SMILES | NC=O |
| Synonym | methanamide,carbamaldehyde,formimidic acid,formic acid, amide,formamid,methanoic acid, amide,amid kyseliny mravenci,amid kyseliny mravenci czech,formic amide,hsdb 88 |
| IUPAC Name | formamide |
| InChI Key | ZHNUHDYFZUAESO-UHFFFAOYSA-N |
| Molecular Formula | CH3NO |
Toluene-d8, for NMR, 100.0 atom % D, packaged in 0.50 ml ampoules
CAS: 2037-26-5 Molecular Formula: C7H8 Molecular Weight (g/mol): 100.19 MDL Number: MFCD00044638 InChI Key: YXFVVABEGXRONW-JGUCLWPXSA-N Synonym: toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d PubChem CID: 74861 IUPAC Name: 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene SMILES: CC1=CC=CC=C1
| PubChem CID | 74861 |
|---|---|
| CAS | 2037-26-5 |
| Molecular Weight (g/mol) | 100.19 |
| MDL Number | MFCD00044638 |
| SMILES | CC1=CC=CC=C1 |
| Synonym | toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene |
| InChI Key | YXFVVABEGXRONW-JGUCLWPXSA-N |
| Molecular Formula | C7H8 |
4-Bromo-N,N,2,6-tetramethylaniline, 98%
CAS: 50638-54-5 Molecular Formula: C10H14BrN Molecular Weight (g/mol): 228.133 MDL Number: MFCD00100113 InChI Key: NDDKEDQKCHIHMI-UHFFFAOYSA-N PubChem CID: 142731 IUPAC Name: 4-bromo-N,N,2,6-tetramethylaniline SMILES: CC1=CC(=CC(=C1N(C)C)C)Br
| PubChem CID | 142731 |
|---|---|
| CAS | 50638-54-5 |
| Molecular Weight (g/mol) | 228.133 |
| MDL Number | MFCD00100113 |
| SMILES | CC1=CC(=CC(=C1N(C)C)C)Br |
| IUPAC Name | 4-bromo-N,N,2,6-tetramethylaniline |
| InChI Key | NDDKEDQKCHIHMI-UHFFFAOYSA-N |
| Molecular Formula | C10H14BrN |
2,5-Dimethylphenyl isocyanate, 97%
CAS: 40397-98-6 Molecular Formula: C9H9NO Molecular Weight (g/mol): 147.18 MDL Number: MFCD00013854 InChI Key: SOXVXJQIQVOCAY-UHFFFAOYSA-N Synonym: 2,5-dimethylphenyl isocyanate,2,5-dimethylphenylisocyanate,benzene, 2-isocyanato-1,4-dimethyl,2,5-dimethyl phenylisocyanate,2,5-dimethylbenzenisocyanate,acmc-1art9,1-isocyanato-2,5-dimethyl-benzene PubChem CID: 98605 ChEBI: CHEBI:60097 IUPAC Name: 2-isocyanato-1,4-dimethylbenzene SMILES: CC1=CC=C(C)C(=C1)N=C=O
| PubChem CID | 98605 |
|---|---|
| CAS | 40397-98-6 |
| Molecular Weight (g/mol) | 147.18 |
| ChEBI | CHEBI:60097 |
| MDL Number | MFCD00013854 |
| SMILES | CC1=CC=C(C)C(=C1)N=C=O |
| Synonym | 2,5-dimethylphenyl isocyanate,2,5-dimethylphenylisocyanate,benzene, 2-isocyanato-1,4-dimethyl,2,5-dimethyl phenylisocyanate,2,5-dimethylbenzenisocyanate,acmc-1art9,1-isocyanato-2,5-dimethyl-benzene |
| IUPAC Name | 2-isocyanato-1,4-dimethylbenzene |
| InChI Key | SOXVXJQIQVOCAY-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO |
3-Fluoro-o-xylene, 99%
CAS: 443-82-3 Molecular Formula: C8H9F Molecular Weight (g/mol): 124.16 MDL Number: MFCD00000323 InChI Key: AWLDSXJCQWTJPC-UHFFFAOYSA-N Synonym: 3-fluoro-o-xylene,2,3-dimethylfluorobenzene,3-fluoro-1,2-xylene,o-xylene, 3-fluoro,3-fluoro-1,2-dimethylbenzene,benzene, 1-fluoro-2,3-dimethyl,1,2-dimethyl-3-fluorobenzene,1-fluoro-2,3-dimethyl-benzene,fluorxylol,pubchem4408 PubChem CID: 96489 IUPAC Name: 1-fluoro-2,3-dimethylbenzene SMILES: CC1=CC=CC(F)=C1C
| PubChem CID | 96489 |
|---|---|
| CAS | 443-82-3 |
| Molecular Weight (g/mol) | 124.16 |
| MDL Number | MFCD00000323 |
| SMILES | CC1=CC=CC(F)=C1C |
| Synonym | 3-fluoro-o-xylene,2,3-dimethylfluorobenzene,3-fluoro-1,2-xylene,o-xylene, 3-fluoro,3-fluoro-1,2-dimethylbenzene,benzene, 1-fluoro-2,3-dimethyl,1,2-dimethyl-3-fluorobenzene,1-fluoro-2,3-dimethyl-benzene,fluorxylol,pubchem4408 |
| IUPAC Name | 1-fluoro-2,3-dimethylbenzene |
| InChI Key | AWLDSXJCQWTJPC-UHFFFAOYSA-N |
| Molecular Formula | C8H9F |
2-Iodo-p-xylene, 98+%
CAS: 1122-42-5 Molecular Formula: C8H9I Molecular Weight (g/mol): 232.064 MDL Number: MFCD00013708 InChI Key: WYZVNUSNUCABRF-UHFFFAOYSA-N Synonym: 2-iodo-p-xylene,1,4-dimethyl-2-iodobenzene,p-xylene, 2-iodo,1-iodo-2,5-dimethylbenzene,benzene, 2-iodo-1,4-dimethyl,2-iodo-4-xylene,2,5-dimethyliodobenzene,2-iodo-1,4-dimethyl-benzene,2,5-dimethyl-1-iodobenzene,pubchem3875 PubChem CID: 70731 IUPAC Name: 2-iodo-1,4-dimethylbenzene SMILES: CC1=CC(=C(C=C1)C)I
| PubChem CID | 70731 |
|---|---|
| CAS | 1122-42-5 |
| Molecular Weight (g/mol) | 232.064 |
| MDL Number | MFCD00013708 |
| SMILES | CC1=CC(=C(C=C1)C)I |
| Synonym | 2-iodo-p-xylene,1,4-dimethyl-2-iodobenzene,p-xylene, 2-iodo,1-iodo-2,5-dimethylbenzene,benzene, 2-iodo-1,4-dimethyl,2-iodo-4-xylene,2,5-dimethyliodobenzene,2-iodo-1,4-dimethyl-benzene,2,5-dimethyl-1-iodobenzene,pubchem3875 |
| IUPAC Name | 2-iodo-1,4-dimethylbenzene |
| InChI Key | WYZVNUSNUCABRF-UHFFFAOYSA-N |
| Molecular Formula | C8H9I |
2-Chloro-6-methylphenyl isocyanate, 97%
CAS: 40398-01-4 Molecular Formula: C8H6ClNO Molecular Weight (g/mol): 167.592 MDL Number: MFCD00037030 InChI Key: FBTQQNYGMICJQZ-UHFFFAOYSA-N Synonym: 2-chloro-6-methylphenyl isocyanate,2-chloro-6-methylphenylisocyanate,benzene, 1-chloro-2-isocyanato-3-methyl,acmc-1ake5,2-chloro-6-methylbenzenisocyanate,2-chloro 6-methyl phenylisocyanate,2-chloro 6-methyl phenyl isocyanate,2-chloro-1-isocyanato-6-methyl benzene,1-chloro-2-isocyanato-3-methyl-benzene,6-chloro-2-methylphenylisocyanate PubChem CID: 268123 IUPAC Name: 1-chloro-2-isocyanato-3-methylbenzene SMILES: CC1=C(C(=CC=C1)Cl)N=C=O
| PubChem CID | 268123 |
|---|---|
| CAS | 40398-01-4 |
| Molecular Weight (g/mol) | 167.592 |
| MDL Number | MFCD00037030 |
| SMILES | CC1=C(C(=CC=C1)Cl)N=C=O |
| Synonym | 2-chloro-6-methylphenyl isocyanate,2-chloro-6-methylphenylisocyanate,benzene, 1-chloro-2-isocyanato-3-methyl,acmc-1ake5,2-chloro-6-methylbenzenisocyanate,2-chloro 6-methyl phenylisocyanate,2-chloro 6-methyl phenyl isocyanate,2-chloro-1-isocyanato-6-methyl benzene,1-chloro-2-isocyanato-3-methyl-benzene,6-chloro-2-methylphenylisocyanate |
| IUPAC Name | 1-chloro-2-isocyanato-3-methylbenzene |
| InChI Key | FBTQQNYGMICJQZ-UHFFFAOYSA-N |
| Molecular Formula | C8H6ClNO |
(R)-(+)-1-(4-Chlorophenyl)ethylamine, ChiPros™ 97%, ee 98%
CAS: 27298-99-3 Molecular Formula: C8H10ClN Molecular Weight (g/mol): 155.625 MDL Number: MFCD00671639 InChI Key: PINPOEWMCLFRRB-ZCFIWIBFSA-N Synonym: r-1-4-chlorophenyl ethylamine,r-1-4-chlorophenyl ethanamine,1r-1-4-chlorophenyl ethanamine,r-+-1-4-chlorophenyl ethylamine,1r-1-4-chlorophenyl ethan-1-amine,benzenemethanamine, 4-chloro-alpha-methyl-, alphar,pubchem15222,r-4-chloro-,a-methylbenzylamine,1r-1-4-chlorophenyl ethylamine,r-1-4-chloro-phenyl ethylamine PubChem CID: 1715226 IUPAC Name: (1R)-1-(4-chlorophenyl)ethanamine SMILES: CC(C1=CC=C(C=C1)Cl)N
| PubChem CID | 1715226 |
|---|---|
| CAS | 27298-99-3 |
| Molecular Weight (g/mol) | 155.625 |
| MDL Number | MFCD00671639 |
| SMILES | CC(C1=CC=C(C=C1)Cl)N |
| Synonym | r-1-4-chlorophenyl ethylamine,r-1-4-chlorophenyl ethanamine,1r-1-4-chlorophenyl ethanamine,r-+-1-4-chlorophenyl ethylamine,1r-1-4-chlorophenyl ethan-1-amine,benzenemethanamine, 4-chloro-alpha-methyl-, alphar,pubchem15222,r-4-chloro-,a-methylbenzylamine,1r-1-4-chlorophenyl ethylamine,r-1-4-chloro-phenyl ethylamine |
| IUPAC Name | (1R)-1-(4-chlorophenyl)ethanamine |
| InChI Key | PINPOEWMCLFRRB-ZCFIWIBFSA-N |
| Molecular Formula | C8H10ClN |
3-chlorophenylacetylene, 97%
CAS: 766-83-6 Molecular Formula: C8H5Cl Molecular Weight (g/mol): 136.58 MDL Number: MFCD03839984 InChI Key: GRBJPHPMYOUMJV-UHFFFAOYSA-N Synonym: 3-chlorophenylacetylene,3-chlorophenyl acetylene,3'-chlorophenyl acetylene,3-chloro-1-ethynylbenzene,benzene, 1-chloro-3-ethynyl,m-chlorophenylacetylene,1-chloro-3-ethynyl-benzene,3'-chlorophenylacetylene,3-chloro phenyl acetylene PubChem CID: 123086 IUPAC Name: 1-chloro-3-ethynylbenzene SMILES: C#CC1=CC(=CC=C1)Cl
| PubChem CID | 123086 |
|---|---|
| CAS | 766-83-6 |
| Molecular Weight (g/mol) | 136.58 |
| MDL Number | MFCD03839984 |
| SMILES | C#CC1=CC(=CC=C1)Cl |
| Synonym | 3-chlorophenylacetylene,3-chlorophenyl acetylene,3'-chlorophenyl acetylene,3-chloro-1-ethynylbenzene,benzene, 1-chloro-3-ethynyl,m-chlorophenylacetylene,1-chloro-3-ethynyl-benzene,3'-chlorophenylacetylene,3-chloro phenyl acetylene |
| IUPAC Name | 1-chloro-3-ethynylbenzene |
| InChI Key | GRBJPHPMYOUMJV-UHFFFAOYSA-N |
| Molecular Formula | C8H5Cl |
Iso-Octane, Purified Plus™, ACS Reagent, for organic synthesis, for prep-LC, >99.0%, Honeywell Burdick & Jackson
CAS: 540-84-1 Molecular Formula: C8H18 Molecular Weight (g/mol): 114.232 InChI Key: NHTMVDHEPJAVLT-UHFFFAOYSA-N Synonym: isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane PubChem CID: 10907 ChEBI: CHEBI:62805 IUPAC Name: 2,2,4-trimethylpentane SMILES: CC(C)CC(C)(C)C
| PubChem CID | 10907 |
|---|---|
| CAS | 540-84-1 |
| Molecular Weight (g/mol) | 114.232 |
| ChEBI | CHEBI:62805 |
| SMILES | CC(C)CC(C)(C)C |
| Synonym | isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane |
| IUPAC Name | 2,2,4-trimethylpentane |
| InChI Key | NHTMVDHEPJAVLT-UHFFFAOYSA-N |
| Molecular Formula | C8H18 |